C31H32ClN7O4 — CID 11376904
7-[3-(3-chloro-4-morpholin-4-ylanilino)phenyl]-5-methyl-N-(3,4,5-trimethoxyphenyl)imidazo[5,1-f][1,2,4]triazin-2-amine (PubChem CID 11376904) has the molecular formula C31H32ClN7O4 and a molecular weight of 602.10 g/mol. Its IUPAC name is 7-[3-(3-chloro-4-morpholin-4-ylanilino)phenyl]-5-methyl-N-(3,4,5-trimethoxyphenyl)imidazo[5,1-f][1,2,4]triazin-2-amine.
| Compound Name | 7-[3-(3-chloro-4-morpholin-4-ylanilino)phenyl]-5-methyl-N-(3,4,5-trimethoxyphenyl)imidazo[5,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 11376904 |
| Molecular Formula | C31H32ClN7O4 |
| Molecular Weight | 602.10 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | 7-[3-(3-chloro-4-morpholin-4-ylanilino)phenyl]-5-methyl-N-(3,4,5-trimethoxyphenyl)imidazo[5,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1cc(Nc2ncc3c(C)nc(-c4cccc(Nc5ccc(N6CCOCC6)c(Cl)c5)c4)n3n2)cc(OC)c1OC |
| InChI | InChI=1S/C31H32ClN7O4/c1-19-26-18-33-31(36-23-16-27(40-2)29(42-4)28(17-23)41-3)37-39(26)30(34-19)20-6-5-7-21(14-20)35-22-8-9-25(24(32)15-22)38-10-12-43-13-11-38/h5-9,14-18,35H,10-13H2,1-4H3,(H,36,37) |
| InChIKey | AVVZHINMCSCTIL-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.10 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|