C34H70O5Si2 — CID 11377032
tert-butyl (E,9S,12S,13S)-12,13-bis[[tert-butyl(dimethyl)silyl]oxy]-9-hydroxyoctadec-10-enoate (PubChem CID 11377032) has the molecular formula C34H70O5Si2 and a molecular weight of 615.10 g/mol. Its IUPAC name is tert-butyl (E,9S,12S,13S)-12,13-bis[[tert-butyl(dimethyl)silyl]oxy]-9-hydroxyoctadec-10-enoate.
| Compound Name | tert-butyl (E,9S,12S,13S)-12,13-bis[[tert-butyl(dimethyl)silyl]oxy]-9-hydroxyoctadec-10-enoate |
|---|---|
| PubChem CID | 11377032 |
| Molecular Formula | C34H70O5Si2 |
| Molecular Weight | 615.10 g/mol |
| Exact Mass | 614.48 |
| IUPAC Name | tert-butyl (E,9S,12S,13S)-12,13-bis[[tert-butyl(dimethyl)silyl]oxy]-9-hydroxyoctadec-10-enoate |
| SMILES | CCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C/[C@@H](O)CCCCCCCC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H70O5Si2/c1-15-16-20-24-29(38-40(11,12)33(5,6)7)30(39-41(13,14)34(8,9)10)27-26-28(35)23-21-18-17-19-22-25-31(36)37-32(2,3)4/h26-30,35H,15-25H2,1-14H3/b27-26+/t28-,29-,30-/m0/s1 |
| InChIKey | YRSAOEMBTMETIG-OPFLKMDCSA-N |
| XLogP | 10.34 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.10 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|