About CID 11377055
CID 11377055 (PubChem CID 11377055) has the molecular formula C22H28BiCl2N2O
and a molecular weight of 616.37 g/mol.
Molecular Properties
| Compound Name | CID 11377055 |
| PubChem CID | 11377055 |
| Molecular Formula | C22H28BiCl2N2O |
| Molecular Weight | 616.37 g/mol |
| Exact Mass | 615.14 |
| IUPAC Name | — |
| SMILES | C1CCC2=NCCCN2CC1.COc1ccc([Bi](Cl)(Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C9H16N2.C7H7O.C6H5.Bi.2ClH/c1-2-5-9-10-6-4-8-11(9)7-3-1;1-8-7-5-3-2-4-6-7;1-2-4-6-5-3-1;;;/h1-8H2;3-6H,1H3;1-5H;;2*1H/q;;;+2;;/p-2 |
| InChIKey | YGXSTAUNMLMRDQ-UHFFFAOYSA-L |
| XLogP | 4.39 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 616.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 11377055 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11377055?
The IUPAC name of CID 11377055 (CID 11377055) is not available.
What is the SMILES notation for CID 11377055?
The canonical SMILES for CID 11377055 is C1CCC2=NCCCN2CC1.COc1ccc([Bi](Cl)(Cl)c2ccccc2)cc1.
What is the InChIKey of CID 11377055?
The InChIKey is YGXSTAUNMLMRDQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H16N2.C7H7O.C6H5.Bi.2ClH/c1-2-5-9-10-6-4-8-11(9)7-3-1;1-8-7-5-3-2-4-6-7;1-2-4-6-5-3-1;;;/h1-8H2;3-6H,1H3;1-5H;;2*1H/q;;;+2;;/p-2.
What are the key properties of CID 11377055?
CID 11377055 has a molecular weight of 616.37 g/mol, XLogP of 4.39, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11377055 is sourced from PubChem (CID 11377055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).