C28H40N6O8S — CID 11377076
2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2-methoxy-3-[4-[3-(5-methylsulfonyloxyindol-1-yl)propylamino]phenyl]propanoic acid (PubChem CID 11377076) has the molecular formula C28H40N6O8S and a molecular weight of 620.73 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2-methoxy-3-[4-[3-(5-methylsulfonyloxyindol-1-yl)propylamino]phenyl]propanoic acid.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2-methoxy-3-[4-[3-(5-methylsulfonyloxyindol-1-yl)propylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 11377076 |
| Molecular Formula | C28H40N6O8S |
| Molecular Weight | 620.73 g/mol |
| Exact Mass | 620.26 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;(2S)-2-methoxy-3-[4-[3-(5-methylsulfonyloxyindol-1-yl)propylamino]phenyl]propanoic acid |
| SMILES | CO[C@@H](Cc1ccc(NCCCn2ccc3cc(OS(C)(=O)=O)ccc32)cc1)C(=O)O.NC(N)=NCCCC(N)C(=O)O |
| InChI | InChI=1S/C22H26N2O6S.C6H14N4O2/c1-29-21(22(25)26)14-16-4-6-18(7-5-16)23-11-3-12-24-13-10-17-15-19(8-9-20(17)24)30-31(2,27)28;7-4(5(11)12)2-1-3-10-6(8)9/h4-10,13,15,21,23H,3,11-12,14H2,1-2H3,(H,25,26);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t21-;/m0./s1 |
| InChIKey | GMGAUACAZBEIHP-BOXHHOBZSA-N |
| XLogP | 1.58 |
| TPSA | 234.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.73 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|