C20H22Br4O6 — CID 11377384
[(1R)-1-[(5S,6S,11R,12R)-1,10,11,12-tetrabromo-2-butyl-3,8-dioxo-4,7-dioxadispiro[4.0.46.25]dodeca-1,9-dien-9-yl]butyl] acetate (PubChem CID 11377384) has the molecular formula C20H22Br4O6 and a molecular weight of 678.01 g/mol. Its IUPAC name is [(1R)-1-[(5S,6S,11R,12R)-1,10,11,12-tetrabromo-2-butyl-3,8-dioxo-4,7-dioxadispiro[4.0.46.25]dodeca-1,9-dien-9-yl]butyl] acetate.
| Compound Name | [(1R)-1-[(5S,6S,11R,12R)-1,10,11,12-tetrabromo-2-butyl-3,8-dioxo-4,7-dioxadispiro[4.0.46.25]dodeca-1,9-dien-9-yl]butyl] acetate |
|---|---|
| PubChem CID | 11377384 |
| Molecular Formula | C20H22Br4O6 |
| Molecular Weight | 678.01 g/mol |
| Exact Mass | 673.81 |
| IUPAC Name | [(1R)-1-[(5S,6S,11R,12R)-1,10,11,12-tetrabromo-2-butyl-3,8-dioxo-4,7-dioxadispiro[4.0.46.25]dodeca-1,9-dien-9-yl]butyl] acetate |
| SMILES | CCCCC1=C(Br)[C@@]2(OC1=O)[C@@H](Br)[C@H](Br)[C@@]21OC(=O)C([C@@H](CCC)OC(C)=O)=C1Br |
| InChI | InChI=1S/C20H22Br4O6/c1-4-6-8-10-13(21)19(29-17(10)26)15(23)16(24)20(19)14(22)12(18(27)30-20)11(7-5-2)28-9(3)25/h11,15-16H,4-8H2,1-3H3/t11-,15+,16+,19-,20-/m1/s1 |
| InChIKey | KJJZJKARRMQVGU-ZYHFBJIYSA-N |
| XLogP | 5.34 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.01 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|