C50H60N10S — CID 11377876
5-[[1-(1,3-benzothiazol-2-yl)-3-tert-butyl-4-cyanopyrazol-5-yl]diazenyl]-4-methyl-2,6-bis(4-octylanilino)pyridine-3-carbonitrile (PubChem CID 11377876) has the molecular formula C50H60N10S and a molecular weight of 833.17 g/mol. Its IUPAC name is 5-[[1-(1,3-benzothiazol-2-yl)-3-tert-butyl-4-cyanopyrazol-5-yl]diazenyl]-4-methyl-2,6-bis(4-octylanilino)pyridine-3-carbonitrile.
| Compound Name | 5-[[1-(1,3-benzothiazol-2-yl)-3-tert-butyl-4-cyanopyrazol-5-yl]diazenyl]-4-methyl-2,6-bis(4-octylanilino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 11377876 |
| Molecular Formula | C50H60N10S |
| Molecular Weight | 833.17 g/mol |
| Exact Mass | 832.47 |
| IUPAC Name | 5-[[1-(1,3-benzothiazol-2-yl)-3-tert-butyl-4-cyanopyrazol-5-yl]diazenyl]-4-methyl-2,6-bis(4-octylanilino)pyridine-3-carbonitrile |
| SMILES | CCCCCCCCc1ccc(Nc2nc(Nc3ccc(CCCCCCCC)cc3)c(/N=N/c3c(C#N)c(C(C)(C)C)nn3-c3nc4ccccc4s3)c(C)c2C#N)cc1 |
| InChI | InChI=1S/C50H60N10S/c1-7-9-11-13-15-17-21-36-25-29-38(30-26-36)53-46-40(33-51)35(3)44(47(56-46)54-39-31-27-37(28-32-39)22-18-16-14-12-10-8-2)57-58-48-41(34-52)45(50(4,5)6)59-60(48)49-55-42-23-19-20-24-43(42)61-49/h19-20,23-32H,7-18,21-22H2,1-6H3,(H2,53,54,56)/b58-57+ |
| InChIKey | RNCHOJVKJCHGNJ-UPRQXYPZSA-N |
| XLogP | 14.93 |
| TPSA | 139.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.17 |
| LogP ≤ 5 | 14.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|