C32H32N2 — CID 11378297
1-N,2-N-bis(2,6-diethylphenyl)acenaphthylene-1,2-diimine (PubChem CID 11378297) has the molecular formula C32H32N2 and a molecular weight of 444.62 g/mol. Its IUPAC name is 1-N,2-N-bis(2,6-diethylphenyl)acenaphthylene-1,2-diimine.
| Compound Name | 1-N,2-N-bis(2,6-diethylphenyl)acenaphthylene-1,2-diimine |
|---|---|
| PubChem CID | 11378297 |
| Molecular Formula | C32H32N2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 1-N,2-N-bis(2,6-diethylphenyl)acenaphthylene-1,2-diimine |
| SMILES | CCc1cccc(CC)c1/N=C1C(=N/c2c(CC)cccc2CC)/c2cccc3cccc/1c23 |
| InChI | InChI=1S/C32H32N2/c1-5-21-13-9-14-22(6-2)29(21)33-31-26-19-11-17-25-18-12-20-27(28(25)26)32(31)34-30-23(7-3)15-10-16-24(30)8-4/h9-20H,5-8H2,1-4H3/b33-31+,34-32+ |
| InChIKey | QDYLFGVRVULBPH-FMWAKIAMSA-N |
| XLogP | 8.34 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|