About (3R,4S)-3,4-dichlorocyclobutene
(3R,4S)-3,4-dichlorocyclobutene (PubChem CID 11378482) has the molecular formula C4H4Cl2
and a molecular weight of 122.98 g/mol. Its IUPAC name is (3R,4S)-3,4-dichlorocyclobutene.
Molecular Properties
| Compound Name | (3R,4S)-3,4-dichlorocyclobutene |
| PubChem CID | 11378482 |
| Molecular Formula | C4H4Cl2 |
| Molecular Weight | 122.98 g/mol |
| Exact Mass | 121.97 |
| IUPAC Name | (3R,4S)-3,4-dichlorocyclobutene |
| SMILES | Cl[C@@H]1C=C[C@@H]1Cl |
| InChI | InChI=1S/C4H4Cl2/c5-3-1-2-4(3)6/h1-4H/t3-,4+ |
| InChIKey | MNOAQNJDZROAPA-ZXZARUISSA-N |
| XLogP | 1.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.98 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R,4S)-3,4-dichlorocyclobutene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-3,4-dichlorocyclobutene?
The IUPAC name of (3R,4S)-3,4-dichlorocyclobutene (CID 11378482) is (3R,4S)-3,4-dichlorocyclobutene.
What is the SMILES notation for (3R,4S)-3,4-dichlorocyclobutene?
The canonical SMILES for (3R,4S)-3,4-dichlorocyclobutene is Cl[C@@H]1C=C[C@@H]1Cl.
What is the InChIKey of (3R,4S)-3,4-dichlorocyclobutene?
The InChIKey is MNOAQNJDZROAPA-ZXZARUISSA-N. The full InChI is InChI=1S/C4H4Cl2/c5-3-1-2-4(3)6/h1-4H/t3-,4+.
What are the key properties of (3R,4S)-3,4-dichlorocyclobutene?
(3R,4S)-3,4-dichlorocyclobutene has a molecular weight of 122.98 g/mol, XLogP of 1.77, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-3,4-dichlorocyclobutene is sourced from PubChem (CID 11378482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).