About (4S)-4-methyl-3,4-dihydrochromen-2-one
(4S)-4-methyl-3,4-dihydrochromen-2-one (PubChem CID 11378664) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol. Its IUPAC name is (4S)-4-methyl-3,4-dihydrochromen-2-one.
Molecular Properties
| Compound Name | (4S)-4-methyl-3,4-dihydrochromen-2-one |
| PubChem CID | 11378664 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (4S)-4-methyl-3,4-dihydrochromen-2-one |
| SMILES | C[C@H]1CC(=O)Oc2ccccc21 |
| InChI | InChI=1S/C10H10O2/c1-7-6-10(11)12-9-5-3-2-4-8(7)9/h2-5,7H,6H2,1H3/t7-/m0/s1 |
| InChIKey | KMCGEYKRTBLDNR-ZETCQYMHSA-N |
| XLogP | 2.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-methyl-3,4-dihydrochromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-methyl-3,4-dihydrochromen-2-one?
The IUPAC name of (4S)-4-methyl-3,4-dihydrochromen-2-one (CID 11378664) is (4S)-4-methyl-3,4-dihydrochromen-2-one.
What is the SMILES notation for (4S)-4-methyl-3,4-dihydrochromen-2-one?
The canonical SMILES for (4S)-4-methyl-3,4-dihydrochromen-2-one is C[C@H]1CC(=O)Oc2ccccc21.
What is the InChIKey of (4S)-4-methyl-3,4-dihydrochromen-2-one?
The InChIKey is KMCGEYKRTBLDNR-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H10O2/c1-7-6-10(11)12-9-5-3-2-4-8(7)9/h2-5,7H,6H2,1H3/t7-/m0/s1.
What are the key properties of (4S)-4-methyl-3,4-dihydrochromen-2-one?
(4S)-4-methyl-3,4-dihydrochromen-2-one has a molecular weight of 162.19 g/mol, XLogP of 2.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-methyl-3,4-dihydrochromen-2-one is sourced from PubChem (CID 11378664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).