About 2,4-dimethoxy-5,6-dimethylpyrimidine
2,4-dimethoxy-5,6-dimethylpyrimidine (PubChem CID 11378723) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 2,4-dimethoxy-5,6-dimethylpyrimidine.
Molecular Properties
| Compound Name | 2,4-dimethoxy-5,6-dimethylpyrimidine |
| PubChem CID | 11378723 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 2,4-dimethoxy-5,6-dimethylpyrimidine |
| SMILES | COc1nc(C)c(C)c(OC)n1 |
| InChI | InChI=1S/C8H12N2O2/c1-5-6(2)9-8(12-4)10-7(5)11-3/h1-4H3 |
| InChIKey | CPPMMDQPZLYGHU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-dimethoxy-5,6-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethoxy-5,6-dimethylpyrimidine?
The IUPAC name of 2,4-dimethoxy-5,6-dimethylpyrimidine (CID 11378723) is 2,4-dimethoxy-5,6-dimethylpyrimidine.
What is the SMILES notation for 2,4-dimethoxy-5,6-dimethylpyrimidine?
The canonical SMILES for 2,4-dimethoxy-5,6-dimethylpyrimidine is COc1nc(C)c(C)c(OC)n1.
What is the InChIKey of 2,4-dimethoxy-5,6-dimethylpyrimidine?
The InChIKey is CPPMMDQPZLYGHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-5-6(2)9-8(12-4)10-7(5)11-3/h1-4H3.
What are the key properties of 2,4-dimethoxy-5,6-dimethylpyrimidine?
2,4-dimethoxy-5,6-dimethylpyrimidine has a molecular weight of 168.20 g/mol, XLogP of 1.11, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethoxy-5,6-dimethylpyrimidine is sourced from PubChem (CID 11378723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).