About 1-methylidene-2-nona-3,8-diynylcyclopropane
1-methylidene-2-nona-3,8-diynylcyclopropane (PubChem CID 11378772) has the molecular formula C13H16
and a molecular weight of 172.27 g/mol. Its IUPAC name is 1-methylidene-2-nona-3,8-diynylcyclopropane.
Molecular Properties
| Compound Name | 1-methylidene-2-nona-3,8-diynylcyclopropane |
| PubChem CID | 11378772 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 1-methylidene-2-nona-3,8-diynylcyclopropane |
| SMILES | C#CCCCC#CCCC1CC1=C |
| InChI | InChI=1S/C13H16/c1-3-4-5-6-7-8-9-10-13-11-12(13)2/h1,13H,2,4-6,9-11H2 |
| InChIKey | HWOHGBFYAWGUOU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methylidene-2-nona-3,8-diynylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylidene-2-nona-3,8-diynylcyclopropane?
The IUPAC name of 1-methylidene-2-nona-3,8-diynylcyclopropane (CID 11378772) is 1-methylidene-2-nona-3,8-diynylcyclopropane.
What is the SMILES notation for 1-methylidene-2-nona-3,8-diynylcyclopropane?
The canonical SMILES for 1-methylidene-2-nona-3,8-diynylcyclopropane is C#CCCCC#CCCC1CC1=C.
What is the InChIKey of 1-methylidene-2-nona-3,8-diynylcyclopropane?
The InChIKey is HWOHGBFYAWGUOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16/c1-3-4-5-6-7-8-9-10-13-11-12(13)2/h1,13H,2,4-6,9-11H2.
What are the key properties of 1-methylidene-2-nona-3,8-diynylcyclopropane?
1-methylidene-2-nona-3,8-diynylcyclopropane has a molecular weight of 172.27 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylidene-2-nona-3,8-diynylcyclopropane is sourced from PubChem (CID 11378772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).