C13H15NO2 — CID 11378954
3-(4-butoxyphenyl)-1,2-oxazole (PubChem CID 11378954) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-(4-butoxyphenyl)-1,2-oxazole.
| Compound Name | 3-(4-butoxyphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 11378954 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 3-(4-butoxyphenyl)-1,2-oxazole |
| SMILES | CCCCOc1ccc(-c2ccon2)cc1 |
| InChI | InChI=1S/C13H15NO2/c1-2-3-9-15-12-6-4-11(5-7-12)13-8-10-16-14-13/h4-8,10H,2-3,9H2,1H3 |
| InChIKey | CCLDRSRWGWGQAI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|