About (3R)-4-(1,3-dithian-2-ylidene)-3-methylpentan-1-ol
(3R)-4-(1,3-dithian-2-ylidene)-3-methylpentan-1-ol (PubChem CID 11378984) has the molecular formula C10H18OS2
and a molecular weight of 218.39 g/mol. Its IUPAC name is (3R)-4-(1,3-dithian-2-ylidene)-3-methylpentan-1-ol.
Molecular Properties
| Compound Name | (3R)-4-(1,3-dithian-2-ylidene)-3-methylpentan-1-ol |
| PubChem CID | 11378984 |
| Molecular Formula | C10H18OS2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (3R)-4-(1,3-dithian-2-ylidene)-3-methylpentan-1-ol |
| SMILES | CC(=C1SCCCS1)[C@H](C)CCO |
| InChI | InChI=1S/C10H18OS2/c1-8(4-5-11)9(2)10-12-6-3-7-13-10/h8,11H,3-7H2,1-2H3/t8-/m1/s1 |
| InChIKey | LOHXRWYIDQOSIG-MRVPVSSYSA-N |
| XLogP | 3.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-4-(1,3-dithian-2-ylidene)-3-methylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4-(1,3-dithian-2-ylidene)-3-methylpentan-1-ol?
The IUPAC name of (3R)-4-(1,3-dithian-2-ylidene)-3-methylpentan-1-ol (CID 11378984) is (3R)-4-(1,3-dithian-2-ylidene)-3-methylpentan-1-ol.
What is the SMILES notation for (3R)-4-(1,3-dithian-2-ylidene)-3-methylpentan-1-ol?
The canonical SMILES for (3R)-4-(1,3-dithian-2-ylidene)-3-methylpentan-1-ol is CC(=C1SCCCS1)[C@H](C)CCO.
What is the InChIKey of (3R)-4-(1,3-dithian-2-ylidene)-3-methylpentan-1-ol?
The InChIKey is LOHXRWYIDQOSIG-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H18OS2/c1-8(4-5-11)9(2)10-12-6-3-7-13-10/h8,11H,3-7H2,1-2H3/t8-/m1/s1.
What are the key properties of (3R)-4-(1,3-dithian-2-ylidene)-3-methylpentan-1-ol?
(3R)-4-(1,3-dithian-2-ylidene)-3-methylpentan-1-ol has a molecular weight of 218.39 g/mol, XLogP of 3.11, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4-(1,3-dithian-2-ylidene)-3-methylpentan-1-ol is sourced from PubChem (CID 11378984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).