C8H11BrO2 — CID 11378987
(1R,2E,4Z)-5-bromo-1-[(2S)-2-methyloxiran-2-yl]penta-2,4-dien-1-ol (PubChem CID 11378987) has the molecular formula C8H11BrO2 and a molecular weight of 219.08 g/mol. Its IUPAC name is (1R,2E,4Z)-5-bromo-1-[(2S)-2-methyloxiran-2-yl]penta-2,4-dien-1-ol.
| Compound Name | (1R,2E,4Z)-5-bromo-1-[(2S)-2-methyloxiran-2-yl]penta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 11378987 |
| Molecular Formula | C8H11BrO2 |
| Molecular Weight | 219.08 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | (1R,2E,4Z)-5-bromo-1-[(2S)-2-methyloxiran-2-yl]penta-2,4-dien-1-ol |
| SMILES | C[C@@]1([C@H](O)/C=C/C=C\Br)CO1 |
| InChI | InChI=1S/C8H11BrO2/c1-8(6-11-8)7(10)4-2-3-5-9/h2-5,7,10H,6H2,1H3/b4-2+,5-3-/t7-,8+/m1/s1 |
| InChIKey | CKTRPMBLYWPBMG-PZNXXSMOSA-N |
| XLogP | 1.60 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.08 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|