About quinolin-2-amine
quinolin-2-amine (PubChem CID 11379) has the molecular formula C9H8N2
and a molecular weight of 144.18 g/mol. Its IUPAC name is quinolin-2-amine.
Molecular Properties
| Compound Name | quinolin-2-amine |
| PubChem CID | 11379 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | quinolin-2-amine |
| SMILES | Nc1ccc2ccccc2n1 |
| InChI | InChI=1S/C9H8N2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H,(H2,10,11) |
| InChIKey | GCMNJUJAKQGROZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze quinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-2-amine?
The IUPAC name of quinolin-2-amine (CID 11379) is quinolin-2-amine.
What is the SMILES notation for quinolin-2-amine?
The canonical SMILES for quinolin-2-amine is Nc1ccc2ccccc2n1.
What is the InChIKey of quinolin-2-amine?
The InChIKey is GCMNJUJAKQGROZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H,(H2,10,11).
What are the key properties of quinolin-2-amine?
quinolin-2-amine has a molecular weight of 144.18 g/mol, XLogP of 1.82, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-2-amine is sourced from PubChem (CID 11379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).