(2S,4S)-4-phenylsulfanylpyrrolidine-2-carboxylic acid

C11H13NO2S — CID 11379084

IUPAC(2S,4S)-4-phenylsulfanylpyrrolidine-2-carboxylic acid
SMILESO=C(O)[C@@H]1C[C@H](Sc2ccccc2)CN1
InChIInChI=1S/C11H13NO2S/c13-11(14)10-6-9(7-12-10)15-8-4-2-1-3-5-8/h1-5,9-10,12H,6-7H2,(H,13,14)/t9-,10-/m0/s1
InChIKeyPCIUUPKYZVILEM-UWVGGRQHSA-N
MW223.30 g/mol
LogP1.59
Rot. Bonds3

About (2S,4S)-4-phenylsulfanylpyrrolidine-2-carboxylic acid

(2S,4S)-4-phenylsulfanylpyrrolidine-2-carboxylic acid (PubChem CID 11379084) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is (2S,4S)-4-phenylsulfanylpyrrolidine-2-carboxylic acid.

Molecular Properties

Compound Name(2S,4S)-4-phenylsulfanylpyrrolidine-2-carboxylic acid
PubChem CID11379084
Molecular FormulaC11H13NO2S
Molecular Weight223.30 g/mol
Exact Mass223.07
IUPAC Name(2S,4S)-4-phenylsulfanylpyrrolidine-2-carboxylic acid
SMILESO=C(O)[C@@H]1C[C@H](Sc2ccccc2)CN1
InChIInChI=1S/C11H13NO2S/c13-11(14)10-6-9(7-12-10)15-8-4-2-1-3-5-8/h1-5,9-10,12H,6-7H2,(H,13,14)/t9-,10-/m0/s1
InChIKeyPCIUUPKYZVILEM-UWVGGRQHSA-N
XLogP1.59
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.30
LogP ≤ 51.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2S,4S)-4-phenylsulfanylpyrrolidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,4S)-4-phenylsulfanylpyrrolidine-2-carboxylic acid?
The IUPAC name of (2S,4S)-4-phenylsulfanylpyrrolidine-2-carboxylic acid (CID 11379084) is (2S,4S)-4-phenylsulfanylpyrrolidine-2-carboxylic acid.
What is the SMILES notation for (2S,4S)-4-phenylsulfanylpyrrolidine-2-carboxylic acid?
The canonical SMILES for (2S,4S)-4-phenylsulfanylpyrrolidine-2-carboxylic acid is O=C(O)[C@@H]1C[C@H](Sc2ccccc2)CN1.
What is the InChIKey of (2S,4S)-4-phenylsulfanylpyrrolidine-2-carboxylic acid?
The InChIKey is PCIUUPKYZVILEM-UWVGGRQHSA-N. The full InChI is InChI=1S/C11H13NO2S/c13-11(14)10-6-9(7-12-10)15-8-4-2-1-3-5-8/h1-5,9-10,12H,6-7H2,(H,13,14)/t9-,10-/m0/s1.
What are the key properties of (2S,4S)-4-phenylsulfanylpyrrolidine-2-carboxylic acid?
(2S,4S)-4-phenylsulfanylpyrrolidine-2-carboxylic acid has a molecular weight of 223.30 g/mol, XLogP of 1.59, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4S)-4-phenylsulfanylpyrrolidine-2-carboxylic acid is sourced from PubChem (CID 11379084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).