About cis-ethyl (1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylate
cis-ethyl (1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylate (PubChem CID 11379297) has the molecular formula C7H10F3NO2
and a molecular weight of 197.16 g/mol. Its IUPAC name is cis-ethyl (1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | cis-ethyl (1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylate |
| PubChem CID | 11379297 |
| Molecular Formula | C7H10F3NO2 |
| Molecular Weight | 197.16 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | cis-ethyl (1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(N)C[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C7H10F3NO2/c1-2-13-5(12)6(11)3-4(6)7(8,9)10/h4H,2-3,11H2,1H3/t4-,6-/m0/s1 |
| InChIKey | QXHOEPWYLQWYND-NJGYIYPDSA-N |
| XLogP | 0.83 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.16 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-ethyl (1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-ethyl (1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylate?
The IUPAC name of cis-ethyl (1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylate (CID 11379297) is cis-ethyl (1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylate.
What is the SMILES notation for cis-ethyl (1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylate?
The canonical SMILES for cis-ethyl (1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylate is CCOC(=O)[C@]1(N)C[C@@H]1C(F)(F)F.
What is the InChIKey of cis-ethyl (1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylate?
The InChIKey is QXHOEPWYLQWYND-NJGYIYPDSA-N. The full InChI is InChI=1S/C7H10F3NO2/c1-2-13-5(12)6(11)3-4(6)7(8,9)10/h4H,2-3,11H2,1H3/t4-,6-/m0/s1.
What are the key properties of cis-ethyl (1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylate?
cis-ethyl (1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylate has a molecular weight of 197.16 g/mol, XLogP of 0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-ethyl (1S,2S)-1-amino-2-(trifluoromethyl)cyclopropane-1-carboxylate is sourced from PubChem (CID 11379297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).