About (5S,6R)-5-acetyl-6-[(Z)-2-ethoxyethenyl]-5-methylcyclohexa-1,3-diene-1-carbaldehyde
(5S,6R)-5-acetyl-6-[(Z)-2-ethoxyethenyl]-5-methylcyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 11379312) has the molecular formula C14H18O3
and a molecular weight of 234.29 g/mol. Its IUPAC name is (5S,6R)-5-acetyl-6-[(Z)-2-ethoxyethenyl]-5-methylcyclohexa-1,3-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | (5S,6R)-5-acetyl-6-[(Z)-2-ethoxyethenyl]-5-methylcyclohexa-1,3-diene-1-carbaldehyde |
| PubChem CID | 11379312 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (5S,6R)-5-acetyl-6-[(Z)-2-ethoxyethenyl]-5-methylcyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | CCO/C=C\[C@@H]1C(C=O)=CC=C[C@]1(C)C(C)=O |
| InChI | InChI=1S/C14H18O3/c1-4-17-9-7-13-12(10-15)6-5-8-14(13,3)11(2)16/h5-10,13H,4H2,1-3H3/b9-7-/t13-,14-/m1/s1 |
| InChIKey | VUUFGXNJRTVVCZ-TXKQXAOOSA-N |
| XLogP | 2.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (5S,6R)-5-acetyl-6-[(Z)-2-ethoxyethenyl]-5-methylcyclohexa-1,3-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S,6R)-5-acetyl-6-[(Z)-2-ethoxyethenyl]-5-methylcyclohexa-1,3-diene-1-carbaldehyde?
The IUPAC name of (5S,6R)-5-acetyl-6-[(Z)-2-ethoxyethenyl]-5-methylcyclohexa-1,3-diene-1-carbaldehyde (CID 11379312) is (5S,6R)-5-acetyl-6-[(Z)-2-ethoxyethenyl]-5-methylcyclohexa-1,3-diene-1-carbaldehyde.
What is the SMILES notation for (5S,6R)-5-acetyl-6-[(Z)-2-ethoxyethenyl]-5-methylcyclohexa-1,3-diene-1-carbaldehyde?
The canonical SMILES for (5S,6R)-5-acetyl-6-[(Z)-2-ethoxyethenyl]-5-methylcyclohexa-1,3-diene-1-carbaldehyde is CCO/C=C\[C@@H]1C(C=O)=CC=C[C@]1(C)C(C)=O.
What is the InChIKey of (5S,6R)-5-acetyl-6-[(Z)-2-ethoxyethenyl]-5-methylcyclohexa-1,3-diene-1-carbaldehyde?
The InChIKey is VUUFGXNJRTVVCZ-TXKQXAOOSA-N. The full InChI is InChI=1S/C14H18O3/c1-4-17-9-7-13-12(10-15)6-5-8-14(13,3)11(2)16/h5-10,13H,4H2,1-3H3/b9-7-/t13-,14-/m1/s1.
What are the key properties of (5S,6R)-5-acetyl-6-[(Z)-2-ethoxyethenyl]-5-methylcyclohexa-1,3-diene-1-carbaldehyde?
(5S,6R)-5-acetyl-6-[(Z)-2-ethoxyethenyl]-5-methylcyclohexa-1,3-diene-1-carbaldehyde has a molecular weight of 234.29 g/mol, XLogP of 2.44, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,6R)-5-acetyl-6-[(Z)-2-ethoxyethenyl]-5-methylcyclohexa-1,3-diene-1-carbaldehyde is sourced from PubChem (CID 11379312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).