C12H17NO4 — CID 11379439
ethyl (1S,7aR)-3-oxo-1-propan-2-yl-1,5-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate (PubChem CID 11379439) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is ethyl (1S,7aR)-3-oxo-1-propan-2-yl-1,5-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate.
| Compound Name | ethyl (1S,7aR)-3-oxo-1-propan-2-yl-1,5-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
|---|---|
| PubChem CID | 11379439 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | ethyl (1S,7aR)-3-oxo-1-propan-2-yl-1,5-dihydropyrrolo[1,2-c][1,3]oxazole-7a-carboxylate |
| SMILES | CCOC(=O)[C@]12C=CCN1C(=O)O[C@H]2C(C)C |
| InChI | InChI=1S/C12H17NO4/c1-4-16-10(14)12-6-5-7-13(12)11(15)17-9(12)8(2)3/h5-6,8-9H,4,7H2,1-3H3/t9-,12+/m0/s1 |
| InChIKey | BJEVGKXTRYZJGT-JOYOIKCWSA-N |
| XLogP | 1.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|