About N,N-dibutyl-3,3,3-trifluoropropanamide
N,N-dibutyl-3,3,3-trifluoropropanamide (PubChem CID 11379443) has the molecular formula C11H20F3NO
and a molecular weight of 239.28 g/mol. Its IUPAC name is N,N-dibutyl-3,3,3-trifluoropropanamide.
Molecular Properties
| Compound Name | N,N-dibutyl-3,3,3-trifluoropropanamide |
| PubChem CID | 11379443 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | N,N-dibutyl-3,3,3-trifluoropropanamide |
| SMILES | CCCCN(CCCC)C(=O)CC(F)(F)F |
| InChI | InChI=1S/C11H20F3NO/c1-3-5-7-15(8-6-4-2)10(16)9-11(12,13)14/h3-9H2,1-2H3 |
| InChIKey | VFOUOYAJUDWKQV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dibutyl-3,3,3-trifluoropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutyl-3,3,3-trifluoropropanamide?
The IUPAC name of N,N-dibutyl-3,3,3-trifluoropropanamide (CID 11379443) is N,N-dibutyl-3,3,3-trifluoropropanamide.
What is the SMILES notation for N,N-dibutyl-3,3,3-trifluoropropanamide?
The canonical SMILES for N,N-dibutyl-3,3,3-trifluoropropanamide is CCCCN(CCCC)C(=O)CC(F)(F)F.
What is the InChIKey of N,N-dibutyl-3,3,3-trifluoropropanamide?
The InChIKey is VFOUOYAJUDWKQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F3NO/c1-3-5-7-15(8-6-4-2)10(16)9-11(12,13)14/h3-9H2,1-2H3.
What are the key properties of N,N-dibutyl-3,3,3-trifluoropropanamide?
N,N-dibutyl-3,3,3-trifluoropropanamide has a molecular weight of 239.28 g/mol, XLogP of 3.37, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutyl-3,3,3-trifluoropropanamide is sourced from PubChem (CID 11379443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).