C12H14F2N2O — CID 11379457
(NE)-N-[(2,4-difluorophenyl)-piperidin-4-ylmethylidene]hydroxylamine (PubChem CID 11379457) has the molecular formula C12H14F2N2O and a molecular weight of 240.25 g/mol. Its IUPAC name is (NE)-N-[(2,4-difluorophenyl)-piperidin-4-ylmethylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2,4-difluorophenyl)-piperidin-4-ylmethylidene]hydroxylamine |
|---|---|
| PubChem CID | 11379457 |
| Molecular Formula | C12H14F2N2O |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | (NE)-N-[(2,4-difluorophenyl)-piperidin-4-ylmethylidene]hydroxylamine |
| SMILES | O/N=C(/c1ccc(F)cc1F)C1CCNCC1 |
| InChI | InChI=1S/C12H14F2N2O/c13-9-1-2-10(11(14)7-9)12(16-17)8-3-5-15-6-4-8/h1-2,7-8,15,17H,3-6H2/b16-12+ |
| InChIKey | DAQWROFRHWHKFE-FOWTUZBSSA-N |
| XLogP | 2.14 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|