C12H16O5 — CID 11379458
(1S,2R,6R,8R,9R)-4,4-dimethyl-9-prop-2-enyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one (PubChem CID 11379458) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is (1S,2R,6R,8R,9R)-4,4-dimethyl-9-prop-2-enyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one.
| Compound Name | (1S,2R,6R,8R,9R)-4,4-dimethyl-9-prop-2-enyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one |
|---|---|
| PubChem CID | 11379458 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (1S,2R,6R,8R,9R)-4,4-dimethyl-9-prop-2-enyl-3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecan-10-one |
| SMILES | C=CC[C@H]1C(=O)O[C@@H]2[C@H]3OC(C)(C)O[C@H]3O[C@@H]21 |
| InChI | InChI=1S/C12H16O5/c1-4-5-6-7-8(14-10(6)13)9-11(15-7)17-12(2,3)16-9/h4,6-9,11H,1,5H2,2-3H3/t6-,7-,8+,9-,11-/m1/s1 |
| InChIKey | GQBAGKGQJUAOLD-ZBGLXGBJSA-N |
| XLogP | 0.98 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|