C12H18O5 — CID 11379503
2-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]prop-2-enyl prop-2-enoate (PubChem CID 11379503) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is 2-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]prop-2-enyl prop-2-enoate.
| Compound Name | 2-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]prop-2-enyl prop-2-enoate |
|---|---|
| PubChem CID | 11379503 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-[(S)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-hydroxymethyl]prop-2-enyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(=C)[C@H](O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C12H18O5/c1-5-10(13)15-6-8(2)11(14)9-7-16-12(3,4)17-9/h5,9,11,14H,1-2,6-7H2,3-4H3/t9-,11+/m1/s1 |
| InChIKey | POFIJFKTAHKVBU-KOLCDFICSA-N |
| XLogP | 0.78 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|