About 2-butyl-1-hex-1-ynyl-3,5-dimethylbenzene
2-butyl-1-hex-1-ynyl-3,5-dimethylbenzene (PubChem CID 11379517) has the molecular formula C18H26
and a molecular weight of 242.41 g/mol. Its IUPAC name is 2-butyl-1-hex-1-ynyl-3,5-dimethylbenzene.
Molecular Properties
| Compound Name | 2-butyl-1-hex-1-ynyl-3,5-dimethylbenzene |
| PubChem CID | 11379517 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 2-butyl-1-hex-1-ynyl-3,5-dimethylbenzene |
| SMILES | CCCCC#Cc1cc(C)cc(C)c1CCCC |
| InChI | InChI=1S/C18H26/c1-5-7-9-10-11-17-14-15(3)13-16(4)18(17)12-8-6-2/h13-14H,5-9,12H2,1-4H3 |
| InChIKey | LMAGBWMUARWCCF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-1-hex-1-ynyl-3,5-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-1-hex-1-ynyl-3,5-dimethylbenzene?
The IUPAC name of 2-butyl-1-hex-1-ynyl-3,5-dimethylbenzene (CID 11379517) is 2-butyl-1-hex-1-ynyl-3,5-dimethylbenzene.
What is the SMILES notation for 2-butyl-1-hex-1-ynyl-3,5-dimethylbenzene?
The canonical SMILES for 2-butyl-1-hex-1-ynyl-3,5-dimethylbenzene is CCCCC#Cc1cc(C)cc(C)c1CCCC.
What is the InChIKey of 2-butyl-1-hex-1-ynyl-3,5-dimethylbenzene?
The InChIKey is LMAGBWMUARWCCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26/c1-5-7-9-10-11-17-14-15(3)13-16(4)18(17)12-8-6-2/h13-14H,5-9,12H2,1-4H3.
What are the key properties of 2-butyl-1-hex-1-ynyl-3,5-dimethylbenzene?
2-butyl-1-hex-1-ynyl-3,5-dimethylbenzene has a molecular weight of 242.41 g/mol, XLogP of 5.19, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-1-hex-1-ynyl-3,5-dimethylbenzene is sourced from PubChem (CID 11379517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).