C13H17NO2S — CID 11379736
4-methyl-N,2-bis(prop-2-enyl)benzenesulfonamide (PubChem CID 11379736) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is 4-methyl-N,2-bis(prop-2-enyl)benzenesulfonamide.
| Compound Name | 4-methyl-N,2-bis(prop-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 11379736 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 4-methyl-N,2-bis(prop-2-enyl)benzenesulfonamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(C)cc1CC=C |
| InChI | InChI=1S/C13H17NO2S/c1-4-6-12-10-11(3)7-8-13(12)17(15,16)14-9-5-2/h4-5,7-8,10,14H,1-2,6,9H2,3H3 |
| InChIKey | RXRBEHQYHKRABE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|