C15H30OSi — CID 11379815
tert-butyl-dimethyl-[(3S,4Z)-nona-4,8-dien-3-yl]oxysilane (PubChem CID 11379815) has the molecular formula C15H30OSi and a molecular weight of 254.49 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3S,4Z)-nona-4,8-dien-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3S,4Z)-nona-4,8-dien-3-yl]oxysilane |
|---|---|
| PubChem CID | 11379815 |
| Molecular Formula | C15H30OSi |
| Molecular Weight | 254.49 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | tert-butyl-dimethyl-[(3S,4Z)-nona-4,8-dien-3-yl]oxysilane |
| SMILES | C=CCC/C=C\[C@H](CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30OSi/c1-8-10-11-12-13-14(9-2)16-17(6,7)15(3,4)5/h8,12-14H,1,9-11H2,2-7H3/b13-12-/t14-/m0/s1 |
| InChIKey | OMOSRYKRDRGCHG-DINCDJDBSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|