C12H19NO5 — CID 11379862
tert-butyl (3aR,7S,7aR)-7-hydroxy-5-oxo-2,3,3a,6,7,7a-hexahydropyrano[3,2-b]pyrrole-1-carboxylate (PubChem CID 11379862) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is tert-butyl (3aR,7S,7aR)-7-hydroxy-5-oxo-2,3,3a,6,7,7a-hexahydropyrano[3,2-b]pyrrole-1-carboxylate.
| Compound Name | tert-butyl (3aR,7S,7aR)-7-hydroxy-5-oxo-2,3,3a,6,7,7a-hexahydropyrano[3,2-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 11379862 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | tert-butyl (3aR,7S,7aR)-7-hydroxy-5-oxo-2,3,3a,6,7,7a-hexahydropyrano[3,2-b]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2OC(=O)C[C@H](O)[C@H]21 |
| InChI | InChI=1S/C12H19NO5/c1-12(2,3)18-11(16)13-5-4-8-10(13)7(14)6-9(15)17-8/h7-8,10,14H,4-6H2,1-3H3/t7-,8+,10+/m0/s1 |
| InChIKey | PLRIFCYIUMESJY-QXFUBDJGSA-N |
| XLogP | 0.67 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |