About [2-(1,3-benzodioxol-5-yl)-1-benzofuran-3-yl]methanol
[2-(1,3-benzodioxol-5-yl)-1-benzofuran-3-yl]methanol (PubChem CID 11380149) has the molecular formula C16H12O4
and a molecular weight of 268.27 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)-1-benzofuran-3-yl]methanol.
Molecular Properties
| Compound Name | [2-(1,3-benzodioxol-5-yl)-1-benzofuran-3-yl]methanol |
| PubChem CID | 11380149 |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yl)-1-benzofuran-3-yl]methanol |
| SMILES | OCc1c(-c2ccc3c(c2)OCO3)oc2ccccc12 |
| InChI | InChI=1S/C16H12O4/c17-8-12-11-3-1-2-4-13(11)20-16(12)10-5-6-14-15(7-10)19-9-18-14/h1-7,17H,8-9H2 |
| InChIKey | TVIZSGMVDSPYAK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(1,3-benzodioxol-5-yl)-1-benzofuran-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-benzodioxol-5-yl)-1-benzofuran-3-yl]methanol?
The IUPAC name of [2-(1,3-benzodioxol-5-yl)-1-benzofuran-3-yl]methanol (CID 11380149) is [2-(1,3-benzodioxol-5-yl)-1-benzofuran-3-yl]methanol.
What is the SMILES notation for [2-(1,3-benzodioxol-5-yl)-1-benzofuran-3-yl]methanol?
The canonical SMILES for [2-(1,3-benzodioxol-5-yl)-1-benzofuran-3-yl]methanol is OCc1c(-c2ccc3c(c2)OCO3)oc2ccccc12.
What is the InChIKey of [2-(1,3-benzodioxol-5-yl)-1-benzofuran-3-yl]methanol?
The InChIKey is TVIZSGMVDSPYAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O4/c17-8-12-11-3-1-2-4-13(11)20-16(12)10-5-6-14-15(7-10)19-9-18-14/h1-7,17H,8-9H2.
What are the key properties of [2-(1,3-benzodioxol-5-yl)-1-benzofuran-3-yl]methanol?
[2-(1,3-benzodioxol-5-yl)-1-benzofuran-3-yl]methanol has a molecular weight of 268.27 g/mol, XLogP of 3.32, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-benzodioxol-5-yl)-1-benzofuran-3-yl]methanol is sourced from PubChem (CID 11380149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).