C13H22N2O4 — CID 11380211
(2R,3S,4S)-5-(2-amino-4,5-dimethylanilino)pentane-1,2,3,4-tetrol (PubChem CID 11380211) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is (2R,3S,4S)-5-(2-amino-4,5-dimethylanilino)pentane-1,2,3,4-tetrol.
| Compound Name | (2R,3S,4S)-5-(2-amino-4,5-dimethylanilino)pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 11380211 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (2R,3S,4S)-5-(2-amino-4,5-dimethylanilino)pentane-1,2,3,4-tetrol |
| SMILES | Cc1cc(N)c(NC[C@H](O)[C@H](O)[C@H](O)CO)cc1C |
| InChI | InChI=1S/C13H22N2O4/c1-7-3-9(14)10(4-8(7)2)15-5-11(17)13(19)12(18)6-16/h3-4,11-13,15-19H,5-6,14H2,1-2H3/t11-,12+,13-/m0/s1 |
| InChIKey | WHEAGFYACXWFAK-XQQFMLRXSA-N |
| XLogP | -0.63 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|