About methyl 2-(3-methoxy-3-oxopropyl)sulfanyl-3,5-dimethylhexanoate
methyl 2-(3-methoxy-3-oxopropyl)sulfanyl-3,5-dimethylhexanoate (PubChem CID 11380372) has the molecular formula C13H24O4S
and a molecular weight of 276.40 g/mol. Its IUPAC name is methyl 2-(3-methoxy-3-oxopropyl)sulfanyl-3,5-dimethylhexanoate.
Analyze methyl 2-(3-methoxy-3-oxopropyl)sulfanyl-3,5-dimethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3-methoxy-3-oxopropyl)sulfanyl-3,5-dimethylhexanoate?
The IUPAC name of methyl 2-(3-methoxy-3-oxopropyl)sulfanyl-3,5-dimethylhexanoate (CID 11380372) is methyl 2-(3-methoxy-3-oxopropyl)sulfanyl-3,5-dimethylhexanoate.
What is the SMILES notation for methyl 2-(3-methoxy-3-oxopropyl)sulfanyl-3,5-dimethylhexanoate?
The canonical SMILES for methyl 2-(3-methoxy-3-oxopropyl)sulfanyl-3,5-dimethylhexanoate is COC(=O)CCSC(C(=O)OC)C(C)CC(C)C.
What is the InChIKey of methyl 2-(3-methoxy-3-oxopropyl)sulfanyl-3,5-dimethylhexanoate?
The InChIKey is JEYPIGRWJWELSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O4S/c1-9(2)8-10(3)12(13(15)17-5)18-7-6-11(14)16-4/h9-10,12H,6-8H2,1-5H3.
What are the key properties of methyl 2-(3-methoxy-3-oxopropyl)sulfanyl-3,5-dimethylhexanoate?
methyl 2-(3-methoxy-3-oxopropyl)sulfanyl-3,5-dimethylhexanoate has a molecular weight of 276.40 g/mol, XLogP of 2.51, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-methoxy-3-oxopropyl)sulfanyl-3,5-dimethylhexanoate is sourced from PubChem (CID 11380372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).