C14H16O6 — CID 11380463
dimethyl 1,3,4,6,8,8a-hexahydrofuro[3,4-e][2]benzofuran-4,5-dicarboxylate (PubChem CID 11380463) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is dimethyl 1,3,4,6,8,8a-hexahydrofuro[3,4-e][2]benzofuran-4,5-dicarboxylate.
| Compound Name | dimethyl 1,3,4,6,8,8a-hexahydrofuro[3,4-e][2]benzofuran-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11380463 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | dimethyl 1,3,4,6,8,8a-hexahydrofuro[3,4-e][2]benzofuran-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C2COCC2C2=C(COC2)C1C(=O)OC |
| InChI | InChI=1S/C14H16O6/c1-17-13(15)11-9-5-19-3-7(9)8-4-20-6-10(8)12(11)14(16)18-2/h7,12H,3-6H2,1-2H3 |
| InChIKey | KFPZIDIUVYYNDD-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|