C16H31NOSi — CID 11380507
4,6,7,8,9,9a-hexahydro-3H-quinolizin-2-ylmethoxy-tert-butyl-dimethylsilane (PubChem CID 11380507) has the molecular formula C16H31NOSi and a molecular weight of 281.52 g/mol. Its IUPAC name is 4,6,7,8,9,9a-hexahydro-3H-quinolizin-2-ylmethoxy-tert-butyl-dimethylsilane.
| Compound Name | 4,6,7,8,9,9a-hexahydro-3H-quinolizin-2-ylmethoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11380507 |
| Molecular Formula | C16H31NOSi |
| Molecular Weight | 281.52 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | 4,6,7,8,9,9a-hexahydro-3H-quinolizin-2-ylmethoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=CC2CCCCN2CC1 |
| InChI | InChI=1S/C16H31NOSi/c1-16(2,3)19(4,5)18-13-14-9-11-17-10-7-6-8-15(17)12-14/h12,15H,6-11,13H2,1-5H3 |
| InChIKey | JWLVPWVBTRAISR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|