About (2-chlorophenyl)methyl selenohypobromite
(2-chlorophenyl)methyl selenohypobromite (PubChem CID 11380583) has the molecular formula C7H6BrClSe
and a molecular weight of 284.44 g/mol. Its IUPAC name is (2-chlorophenyl)methyl selenohypobromite.
Molecular Properties
| Compound Name | (2-chlorophenyl)methyl selenohypobromite |
| PubChem CID | 11380583 |
| Molecular Formula | C7H6BrClSe |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 283.85 |
| IUPAC Name | (2-chlorophenyl)methyl selenohypobromite |
| SMILES | Clc1ccccc1C[Se]Br |
| InChI | InChI=1S/C7H6BrClSe/c8-10-5-6-3-1-2-4-7(6)9/h1-4H,5H2 |
| InChIKey | FYXXTPLLXMGMQY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-chlorophenyl)methyl selenohypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl)methyl selenohypobromite?
The IUPAC name of (2-chlorophenyl)methyl selenohypobromite (CID 11380583) is (2-chlorophenyl)methyl selenohypobromite.
What is the SMILES notation for (2-chlorophenyl)methyl selenohypobromite?
The canonical SMILES for (2-chlorophenyl)methyl selenohypobromite is Clc1ccccc1C[Se]Br.
What is the InChIKey of (2-chlorophenyl)methyl selenohypobromite?
The InChIKey is FYXXTPLLXMGMQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrClSe/c8-10-5-6-3-1-2-4-7(6)9/h1-4H,5H2.
What are the key properties of (2-chlorophenyl)methyl selenohypobromite?
(2-chlorophenyl)methyl selenohypobromite has a molecular weight of 284.44 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl)methyl selenohypobromite is sourced from PubChem (CID 11380583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).