C14H18O7 — CID 11380976
[(2S,3S)-2-[[(2S)-2-hydroxypropanoyl]oxymethyl]-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate (PubChem CID 11380976) has the molecular formula C14H18O7 and a molecular weight of 298.29 g/mol. Its IUPAC name is [(2S,3S)-2-[[(2S)-2-hydroxypropanoyl]oxymethyl]-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(2S,3S)-2-[[(2S)-2-hydroxypropanoyl]oxymethyl]-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 11380976 |
| Molecular Formula | C14H18O7 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [(2S,3S)-2-[[(2S)-2-hydroxypropanoyl]oxymethyl]-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@H]1C=CC(=O)O[C@H]1COC(=O)[C@H](C)O |
| InChI | InChI=1S/C14H18O7/c1-4-8(2)13(17)21-10-5-6-12(16)20-11(10)7-19-14(18)9(3)15/h4-6,9-11,15H,7H2,1-3H3/b8-4+/t9-,10-,11-/m0/s1 |
| InChIKey | FKBITCOIJAFLNT-SPJFXFQZSA-N |
| XLogP | 0.27 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|