C17H34O2Si — CID 11381004
(4E,6S,7Z)-1-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylnona-4,7-dien-3-ol (PubChem CID 11381004) has the molecular formula C17H34O2Si and a molecular weight of 298.54 g/mol. Its IUPAC name is (4E,6S,7Z)-1-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylnona-4,7-dien-3-ol.
| Compound Name | (4E,6S,7Z)-1-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylnona-4,7-dien-3-ol |
|---|---|
| PubChem CID | 11381004 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (4E,6S,7Z)-1-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylnona-4,7-dien-3-ol |
| SMILES | C/C=C\[C@H](C)/C=C(\C)C(O)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O2Si/c1-9-10-14(2)13-15(3)16(18)11-12-19-20(7,8)17(4,5)6/h9-10,13-14,16,18H,11-12H2,1-8H3/b10-9-,15-13+/t14-,16?/m0/s1 |
| InChIKey | BHNURPZVVOFRBP-PYQYPMBGSA-N |
| XLogP | 4.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|