C18H36O3 — CID 11381060
1,14-dihydroxy-2,2,13,13-tetramethyltetradecan-7-one (PubChem CID 11381060) has the molecular formula C18H36O3 and a molecular weight of 300.48 g/mol. Its IUPAC name is 1,14-dihydroxy-2,2,13,13-tetramethyltetradecan-7-one.
| Compound Name | 1,14-dihydroxy-2,2,13,13-tetramethyltetradecan-7-one |
|---|---|
| PubChem CID | 11381060 |
| Molecular Formula | C18H36O3 |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | 1,14-dihydroxy-2,2,13,13-tetramethyltetradecan-7-one |
| SMILES | CC(C)(CO)CCCCCC(=O)CCCCC(C)(C)CO |
| InChI | InChI=1S/C18H36O3/c1-17(2,14-19)12-8-5-6-10-16(21)11-7-9-13-18(3,4)15-20/h19-20H,5-15H2,1-4H3 |
| InChIKey | NUZKBULRMNWJOA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|