C20H20N2O — CID 11381163
2-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)fluoren-9-one (PubChem CID 11381163) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)fluoren-9-one.
| Compound Name | 2-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)fluoren-9-one |
|---|---|
| PubChem CID | 11381163 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 2-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)fluoren-9-one |
| SMILES | CN1CC2CN(c3ccc4c(c3)C(=O)c3ccccc3-4)CC2C1 |
| InChI | InChI=1S/C20H20N2O/c1-21-9-13-11-22(12-14(13)10-21)15-6-7-17-16-4-2-3-5-18(16)20(23)19(17)8-15/h2-8,13-14H,9-12H2,1H3 |
| InChIKey | BTYHECXMCMQKBV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |