C14H17N2O6+ — CID 11381302
(4E)-4-[2-(2-carboxypyrrolidin-1-ium-1-ylidene)ethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid (PubChem CID 11381302) has the molecular formula C14H17N2O6+ and a molecular weight of 309.30 g/mol. Its IUPAC name is (4E)-4-[2-(2-carboxypyrrolidin-1-ium-1-ylidene)ethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid.
| Compound Name | (4E)-4-[2-(2-carboxypyrrolidin-1-ium-1-ylidene)ethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 11381302 |
| Molecular Formula | C14H17N2O6+ |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (4E)-4-[2-(2-carboxypyrrolidin-1-ium-1-ylidene)ethylidene]-2,3-dihydro-1H-pyridine-2,6-dicarboxylic acid |
| SMILES | O=C(O)C1=C/C(=C/C=[N+]2/CCCC2C(=O)O)CC(C(=O)O)N1 |
| InChI | InChI=1S/C14H16N2O6/c17-12(18)9-6-8(7-10(15-9)13(19)20)3-5-16-4-1-2-11(16)14(21)22/h3,5-6,10-11H,1-2,4,7H2,(H3,17,18,19,20,21,22)/p+1 |
| InChIKey | RJIIQBYZGJSODH-UHFFFAOYSA-O |
| XLogP | -0.34 |
| TPSA | 126.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|