C17H15FN2OS — CID 11381456
2-(1H-benzimidazol-2-ylmethylsulfanyl)-1-(4-fluoro-3-methylphenyl)ethanone (PubChem CID 11381456) has the molecular formula C17H15FN2OS and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-ylmethylsulfanyl)-1-(4-fluoro-3-methylphenyl)ethanone.
| Compound Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-1-(4-fluoro-3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 11381456 |
| Molecular Formula | C17H15FN2OS |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-(1H-benzimidazol-2-ylmethylsulfanyl)-1-(4-fluoro-3-methylphenyl)ethanone |
| SMILES | Cc1cc(C(=O)CSCc2nc3ccccc3[nH]2)ccc1F |
| InChI | InChI=1S/C17H15FN2OS/c1-11-8-12(6-7-13(11)18)16(21)9-22-10-17-19-14-4-2-3-5-15(14)20-17/h2-8H,9-10H2,1H3,(H,19,20) |
| InChIKey | HVIXTNQCQATAIT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |