About 4-(4-amino-2,6-difluorophenyl)-1-benzylpiperidin-4-ol
4-(4-amino-2,6-difluorophenyl)-1-benzylpiperidin-4-ol (PubChem CID 11381559) has the molecular formula C18H20F2N2O
and a molecular weight of 318.37 g/mol. Its IUPAC name is 4-(4-amino-2,6-difluorophenyl)-1-benzylpiperidin-4-ol.
Molecular Properties
| Compound Name | 4-(4-amino-2,6-difluorophenyl)-1-benzylpiperidin-4-ol |
| PubChem CID | 11381559 |
| Molecular Formula | C18H20F2N2O |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 4-(4-amino-2,6-difluorophenyl)-1-benzylpiperidin-4-ol |
| SMILES | Nc1cc(F)c(C2(O)CCN(Cc3ccccc3)CC2)c(F)c1 |
| InChI | InChI=1S/C18H20F2N2O/c19-15-10-14(21)11-16(20)17(15)18(23)6-8-22(9-7-18)12-13-4-2-1-3-5-13/h1-5,10-11,23H,6-9,12,21H2 |
| InChIKey | XIWDDSAHVHZTGF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-amino-2,6-difluorophenyl)-1-benzylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-2,6-difluorophenyl)-1-benzylpiperidin-4-ol?
The IUPAC name of 4-(4-amino-2,6-difluorophenyl)-1-benzylpiperidin-4-ol (CID 11381559) is 4-(4-amino-2,6-difluorophenyl)-1-benzylpiperidin-4-ol.
What is the SMILES notation for 4-(4-amino-2,6-difluorophenyl)-1-benzylpiperidin-4-ol?
The canonical SMILES for 4-(4-amino-2,6-difluorophenyl)-1-benzylpiperidin-4-ol is Nc1cc(F)c(C2(O)CCN(Cc3ccccc3)CC2)c(F)c1.
What is the InChIKey of 4-(4-amino-2,6-difluorophenyl)-1-benzylpiperidin-4-ol?
The InChIKey is XIWDDSAHVHZTGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20F2N2O/c19-15-10-14(21)11-16(20)17(15)18(23)6-8-22(9-7-18)12-13-4-2-1-3-5-13/h1-5,10-11,23H,6-9,12,21H2.
What are the key properties of 4-(4-amino-2,6-difluorophenyl)-1-benzylpiperidin-4-ol?
4-(4-amino-2,6-difluorophenyl)-1-benzylpiperidin-4-ol has a molecular weight of 318.37 g/mol, XLogP of 3.03, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-2,6-difluorophenyl)-1-benzylpiperidin-4-ol is sourced from PubChem (CID 11381559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).