C21H22N2O — CID 11381576
N-(3-cyanophenyl)-4-[(E)-4,4-dimethylpent-2-en-2-yl]benzamide (PubChem CID 11381576) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is N-(3-cyanophenyl)-4-[(E)-4,4-dimethylpent-2-en-2-yl]benzamide.
| Compound Name | N-(3-cyanophenyl)-4-[(E)-4,4-dimethylpent-2-en-2-yl]benzamide |
|---|---|
| PubChem CID | 11381576 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | N-(3-cyanophenyl)-4-[(E)-4,4-dimethylpent-2-en-2-yl]benzamide |
| SMILES | C/C(=C\C(C)(C)C)c1ccc(C(=O)Nc2cccc(C#N)c2)cc1 |
| InChI | InChI=1S/C21H22N2O/c1-15(13-21(2,3)4)17-8-10-18(11-9-17)20(24)23-19-7-5-6-16(12-19)14-22/h5-13H,1-4H3,(H,23,24)/b15-13+ |
| InChIKey | QNJWMTCXBTZOHH-FYWRMAATSA-N |
| XLogP | 5.26 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |