C19H28O4 — CID 11381628
(1R,5R,8S,11R)-5-hydroxy-7,11-dimethyl-3,4-di(propan-2-yloxy)tricyclo[6.3.0.01,5]undeca-3,6-dien-2-one (PubChem CID 11381628) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (1R,5R,8S,11R)-5-hydroxy-7,11-dimethyl-3,4-di(propan-2-yloxy)tricyclo[6.3.0.01,5]undeca-3,6-dien-2-one.
| Compound Name | (1R,5R,8S,11R)-5-hydroxy-7,11-dimethyl-3,4-di(propan-2-yloxy)tricyclo[6.3.0.01,5]undeca-3,6-dien-2-one |
|---|---|
| PubChem CID | 11381628 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (1R,5R,8S,11R)-5-hydroxy-7,11-dimethyl-3,4-di(propan-2-yloxy)tricyclo[6.3.0.01,5]undeca-3,6-dien-2-one |
| SMILES | CC1=C[C@]2(O)C(OC(C)C)=C(OC(C)C)C(=O)[C@@]23[C@H](C)CC[C@@H]13 |
| InChI | InChI=1S/C19H28O4/c1-10(2)22-15-16(20)19-13(6)7-8-14(19)12(5)9-18(19,21)17(15)23-11(3)4/h9-11,13-14,21H,7-8H2,1-6H3/t13-,14+,18+,19+/m1/s1 |
| InChIKey | BHZGZSIYUJNGLG-WXRFYESLSA-N |
| XLogP | 3.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|