C19H30O4 — CID 11381692
(5R,6R)-6-acetyl-6-(3,3-diethoxypropyl)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one (PubChem CID 11381692) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is (5R,6R)-6-acetyl-6-(3,3-diethoxypropyl)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one.
| Compound Name | (5R,6R)-6-acetyl-6-(3,3-diethoxypropyl)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11381692 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (5R,6R)-6-acetyl-6-(3,3-diethoxypropyl)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
| SMILES | C=C(C)[C@H]1CC=C(C)C(=O)[C@@]1(CCC(OCC)OCC)C(C)=O |
| InChI | InChI=1S/C19H30O4/c1-7-22-17(23-8-2)11-12-19(15(6)20)16(13(3)4)10-9-14(5)18(19)21/h9,16-17H,3,7-8,10-12H2,1-2,4-6H3/t16-,19+/m1/s1 |
| InChIKey | SORXHVHQNVFEPQ-APWZRJJASA-N |
| XLogP | 3.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|