About 5-amino-4-cyano-1-(2,4,6-trichlorophenyl)pyrazole-3-carboxamide
5-amino-4-cyano-1-(2,4,6-trichlorophenyl)pyrazole-3-carboxamide (PubChem CID 11381951) has the molecular formula C11H6Cl3N5O
and a molecular weight of 330.56 g/mol. Its IUPAC name is 5-amino-4-cyano-1-(2,4,6-trichlorophenyl)pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-amino-4-cyano-1-(2,4,6-trichlorophenyl)pyrazole-3-carboxamide |
| PubChem CID | 11381951 |
| Molecular Formula | C11H6Cl3N5O |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 328.96 |
| IUPAC Name | 5-amino-4-cyano-1-(2,4,6-trichlorophenyl)pyrazole-3-carboxamide |
| SMILES | N#Cc1c(C(N)=O)nn(-c2c(Cl)cc(Cl)cc2Cl)c1N |
| InChI | InChI=1S/C11H6Cl3N5O/c12-4-1-6(13)9(7(14)2-4)19-10(16)5(3-15)8(18-19)11(17)20/h1-2H,16H2,(H2,17,20) |
| InChIKey | PFNMXTHYKXYMTH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-4-cyano-1-(2,4,6-trichlorophenyl)pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-cyano-1-(2,4,6-trichlorophenyl)pyrazole-3-carboxamide?
The IUPAC name of 5-amino-4-cyano-1-(2,4,6-trichlorophenyl)pyrazole-3-carboxamide (CID 11381951) is 5-amino-4-cyano-1-(2,4,6-trichlorophenyl)pyrazole-3-carboxamide.
What is the SMILES notation for 5-amino-4-cyano-1-(2,4,6-trichlorophenyl)pyrazole-3-carboxamide?
The canonical SMILES for 5-amino-4-cyano-1-(2,4,6-trichlorophenyl)pyrazole-3-carboxamide is N#Cc1c(C(N)=O)nn(-c2c(Cl)cc(Cl)cc2Cl)c1N.
What is the InChIKey of 5-amino-4-cyano-1-(2,4,6-trichlorophenyl)pyrazole-3-carboxamide?
The InChIKey is PFNMXTHYKXYMTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6Cl3N5O/c12-4-1-6(13)9(7(14)2-4)19-10(16)5(3-15)8(18-19)11(17)20/h1-2H,16H2,(H2,17,20).
What are the key properties of 5-amino-4-cyano-1-(2,4,6-trichlorophenyl)pyrazole-3-carboxamide?
5-amino-4-cyano-1-(2,4,6-trichlorophenyl)pyrazole-3-carboxamide has a molecular weight of 330.56 g/mol, XLogP of 2.39, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-cyano-1-(2,4,6-trichlorophenyl)pyrazole-3-carboxamide is sourced from PubChem (CID 11381951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).