C7H4F12O — CID 11381976
2,2,3,4,4,5,6,6,6-nonafluoro-3-(trifluoromethyl)hexan-1-ol (PubChem CID 11381976) has the molecular formula C7H4F12O and a molecular weight of 332.08 g/mol. Its IUPAC name is 2,2,3,4,4,5,6,6,6-nonafluoro-3-(trifluoromethyl)hexan-1-ol.
| Compound Name | 2,2,3,4,4,5,6,6,6-nonafluoro-3-(trifluoromethyl)hexan-1-ol |
|---|---|
| PubChem CID | 11381976 |
| Molecular Formula | C7H4F12O |
| Molecular Weight | 332.08 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 2,2,3,4,4,5,6,6,6-nonafluoro-3-(trifluoromethyl)hexan-1-ol |
| SMILES | OCC(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C7H4F12O/c8-2(5(13,14)15)4(11,12)6(16,7(17,18)19)3(9,10)1-20/h2,20H,1H2 |
| InChIKey | DEKXGSJIFAGYPI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.08 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |