C19H28O5 — CID 11382114
(2'R,4'aR,4'bR,8'aS)-4'b-(1,3-dioxolan-2-yl)spiro[1,3-dioxolane-2,8'-2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene]-2'-ol (PubChem CID 11382114) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is (2'R,4'aR,4'bR,8'aS)-4'b-(1,3-dioxolan-2-yl)spiro[1,3-dioxolane-2,8'-2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene]-2'-ol.
| Compound Name | (2'R,4'aR,4'bR,8'aS)-4'b-(1,3-dioxolan-2-yl)spiro[1,3-dioxolane-2,8'-2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene]-2'-ol |
|---|---|
| PubChem CID | 11382114 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (2'R,4'aR,4'bR,8'aS)-4'b-(1,3-dioxolan-2-yl)spiro[1,3-dioxolane-2,8'-2,3,4,4a,5,6,7,8a,9,10-decahydrophenanthrene]-2'-ol |
| SMILES | O[C@H]1C=C2CC[C@@H]3C4(CCC[C@@]3(C3OCCO3)[C@@H]2CC1)OCCO4 |
| InChI | InChI=1S/C19H28O5/c20-14-3-4-15-13(12-14)2-5-16-18(15,17-21-8-9-22-17)6-1-7-19(16)23-10-11-24-19/h12,14-17,20H,1-11H2/t14-,15-,16+,18-/m1/s1 |
| InChIKey | LJXCHHHMJDGYDM-XLMAVXFVSA-N |
| XLogP | 2.38 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|