C17H24BrNO — CID 11382156
(5R,6S)-2-benzyl-3-(bromomethyl)-2-azaspiro[4.5]decan-6-ol (PubChem CID 11382156) has the molecular formula C17H24BrNO and a molecular weight of 338.29 g/mol. Its IUPAC name is (5R,6S)-2-benzyl-3-(bromomethyl)-2-azaspiro[4.5]decan-6-ol.
| Compound Name | (5R,6S)-2-benzyl-3-(bromomethyl)-2-azaspiro[4.5]decan-6-ol |
|---|---|
| PubChem CID | 11382156 |
| Molecular Formula | C17H24BrNO |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | (5R,6S)-2-benzyl-3-(bromomethyl)-2-azaspiro[4.5]decan-6-ol |
| SMILES | O[C@H]1CCCC[C@]12CC(CBr)N(Cc1ccccc1)C2 |
| InChI | InChI=1S/C17H24BrNO/c18-11-15-10-17(9-5-4-8-16(17)20)13-19(15)12-14-6-2-1-3-7-14/h1-3,6-7,15-16,20H,4-5,8-13H2/t15?,16-,17+/m0/s1 |
| InChIKey | UMVPUPFJKFIXPJ-LRUHZDSUSA-N |
| XLogP | 3.58 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|