C13H12ClN3O4S — CID 11382272
4-[(3aS,4R)-4-hydroxy-1,1,3-trioxo-3a,4,5,6-tetrahydropyrrolo[1,2-b][1,2,5]thiadiazol-2-yl]-2-chloro-3-methylbenzonitrile (PubChem CID 11382272) has the molecular formula C13H12ClN3O4S and a molecular weight of 341.78 g/mol. Its IUPAC name is 4-[(3aS,4R)-4-hydroxy-1,1,3-trioxo-3a,4,5,6-tetrahydropyrrolo[1,2-b][1,2,5]thiadiazol-2-yl]-2-chloro-3-methylbenzonitrile.
| Compound Name | 4-[(3aS,4R)-4-hydroxy-1,1,3-trioxo-3a,4,5,6-tetrahydropyrrolo[1,2-b][1,2,5]thiadiazol-2-yl]-2-chloro-3-methylbenzonitrile |
|---|---|
| PubChem CID | 11382272 |
| Molecular Formula | C13H12ClN3O4S |
| Molecular Weight | 341.78 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 4-[(3aS,4R)-4-hydroxy-1,1,3-trioxo-3a,4,5,6-tetrahydropyrrolo[1,2-b][1,2,5]thiadiazol-2-yl]-2-chloro-3-methylbenzonitrile |
| SMILES | Cc1c(N2C(=O)[C@@H]3[C@H](O)CCN3S2(=O)=O)ccc(C#N)c1Cl |
| InChI | InChI=1S/C13H12ClN3O4S/c1-7-9(3-2-8(6-15)11(7)14)17-13(19)12-10(18)4-5-16(12)22(17,20)21/h2-3,10,12,18H,4-5H2,1H3/t10-,12+/m1/s1 |
| InChIKey | HUVHMQXDGTUBFP-PWSUYJOCSA-N |
| XLogP | 0.55 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.78 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |