About 1-cyclohexyl-4-[(2,4-difluorophenyl)methoxy]-3,6-dimethylpyridin-2-one
1-cyclohexyl-4-[(2,4-difluorophenyl)methoxy]-3,6-dimethylpyridin-2-one (PubChem CID 11382435) has the molecular formula C20H23F2NO2
and a molecular weight of 347.41 g/mol. Its IUPAC name is 1-cyclohexyl-4-[(2,4-difluorophenyl)methoxy]-3,6-dimethylpyridin-2-one.
Molecular Properties
| Compound Name | 1-cyclohexyl-4-[(2,4-difluorophenyl)methoxy]-3,6-dimethylpyridin-2-one |
| PubChem CID | 11382435 |
| Molecular Formula | C20H23F2NO2 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 1-cyclohexyl-4-[(2,4-difluorophenyl)methoxy]-3,6-dimethylpyridin-2-one |
| SMILES | Cc1c(OCc2ccc(F)cc2F)cc(C)n(C2CCCCC2)c1=O |
| InChI | InChI=1S/C20H23F2NO2/c1-13-10-19(25-12-15-8-9-16(21)11-18(15)22)14(2)20(24)23(13)17-6-4-3-5-7-17/h8-11,17H,3-7,12H2,1-2H3 |
| InChIKey | ITTUOMKUEYHXTL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclohexyl-4-[(2,4-difluorophenyl)methoxy]-3,6-dimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-4-[(2,4-difluorophenyl)methoxy]-3,6-dimethylpyridin-2-one?
The IUPAC name of 1-cyclohexyl-4-[(2,4-difluorophenyl)methoxy]-3,6-dimethylpyridin-2-one (CID 11382435) is 1-cyclohexyl-4-[(2,4-difluorophenyl)methoxy]-3,6-dimethylpyridin-2-one.
What is the SMILES notation for 1-cyclohexyl-4-[(2,4-difluorophenyl)methoxy]-3,6-dimethylpyridin-2-one?
The canonical SMILES for 1-cyclohexyl-4-[(2,4-difluorophenyl)methoxy]-3,6-dimethylpyridin-2-one is Cc1c(OCc2ccc(F)cc2F)cc(C)n(C2CCCCC2)c1=O.
What is the InChIKey of 1-cyclohexyl-4-[(2,4-difluorophenyl)methoxy]-3,6-dimethylpyridin-2-one?
The InChIKey is ITTUOMKUEYHXTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23F2NO2/c1-13-10-19(25-12-15-8-9-16(21)11-18(15)22)14(2)20(24)23(13)17-6-4-3-5-7-17/h8-11,17H,3-7,12H2,1-2H3.
What are the key properties of 1-cyclohexyl-4-[(2,4-difluorophenyl)methoxy]-3,6-dimethylpyridin-2-one?
1-cyclohexyl-4-[(2,4-difluorophenyl)methoxy]-3,6-dimethylpyridin-2-one has a molecular weight of 347.41 g/mol, XLogP of 4.83, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-4-[(2,4-difluorophenyl)methoxy]-3,6-dimethylpyridin-2-one is sourced from PubChem (CID 11382435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).