C21H34O4 — CID 11382533
methyl (1S,4S,9S,10R,13R,14R)-17-hydroxy-5,5,9-trimethyl-16-oxatetracyclo[8.7.0.01,14.04,9]heptadecane-13-carboxylate (PubChem CID 11382533) has the molecular formula C21H34O4 and a molecular weight of 350.50 g/mol. Its IUPAC name is methyl (1S,4S,9S,10R,13R,14R)-17-hydroxy-5,5,9-trimethyl-16-oxatetracyclo[8.7.0.01,14.04,9]heptadecane-13-carboxylate.
| Compound Name | methyl (1S,4S,9S,10R,13R,14R)-17-hydroxy-5,5,9-trimethyl-16-oxatetracyclo[8.7.0.01,14.04,9]heptadecane-13-carboxylate |
|---|---|
| PubChem CID | 11382533 |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | methyl (1S,4S,9S,10R,13R,14R)-17-hydroxy-5,5,9-trimethyl-16-oxatetracyclo[8.7.0.01,14.04,9]heptadecane-13-carboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@@H]2[C@@]3(C)CCCC(C)(C)[C@@H]3CC[C@]23C(O)OC[C@H]13 |
| InChI | InChI=1S/C21H34O4/c1-19(2)9-5-10-20(3)15(19)8-11-21-14(12-25-18(21)23)13(17(22)24-4)6-7-16(20)21/h13-16,18,23H,5-12H2,1-4H3/t13-,14-,15+,16-,18?,20+,21-/m1/s1 |
| InChIKey | WZNBEJSEYWWDTO-XZEVYESPSA-N |
| XLogP | 3.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |